C27H37NO6Si — CID 11071123
tert-butyl N-[(1S,2S,3R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]carbamate (PubChem CID 11071123) has the molecular formula C27H37NO6Si and a molecular weight of 499.68 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S,3R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S,3R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]carbamate |
|---|---|
| PubChem CID | 11071123 |
| Molecular Formula | C27H37NO6Si |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | tert-butyl N-[(1S,2S,3R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1[C@@H](O)[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC[C@H]1O2 |
| InChI | InChI=1S/C27H37NO6Si/c1-26(2,3)33-25(30)28-21-20-17-31-24(32-20)23(22(21)29)34-35(27(4,5)6,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-16,20-24,29H,17H2,1-6H3,(H,28,30)/t20-,21-,22-,23+,24-/m1/s1 |
| InChIKey | OWUYMGBYEAKQKB-ZSXJVMONSA-N |
| XLogP | 2.94 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|