C25H32Cl3NO7Si — CID 11678766
2,2,2-trichloroethyl N-[2-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate (PubChem CID 11678766) has the molecular formula C25H32Cl3NO7Si and a molecular weight of 592.98 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[2-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[2-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 11678766 |
| Molecular Formula | C25H32Cl3NO7Si |
| Molecular Weight | 592.98 g/mol |
| Exact Mass | 591.10 |
| IUPAC Name | 2,2,2-trichloroethyl N-[2-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate |
| SMILES | CC(C)(C)[Si](OC1OC(CO)C(O)C(O)C1NC(=O)OCC(Cl)(Cl)Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H32Cl3NO7Si/c1-24(2,3)37(16-10-6-4-7-11-16,17-12-8-5-9-13-17)36-22-19(21(32)20(31)18(14-30)35-22)29-23(33)34-15-25(26,27)28/h4-13,18-22,30-32H,14-15H2,1-3H3,(H,29,33) |
| InChIKey | CORRAMPBDGKLEJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.98 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|