C25H32F3NO6Si — CID 101248139
N-[(2S,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-methoxyoxan-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 101248139) has the molecular formula C25H32F3NO6Si and a molecular weight of 527.61 g/mol. Its IUPAC name is N-[(2S,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-methoxyoxan-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-methoxyoxan-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 101248139 |
| Molecular Formula | C25H32F3NO6Si |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | N-[(2S,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-methoxyoxan-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | CO[C@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C25H32F3NO6Si/c1-24(2,3)36(16-11-7-5-8-12-16,17-13-9-6-10-14-17)34-15-18-20(30)21(31)19(22(33-4)35-18)29-23(32)25(26,27)28/h5-14,18-22,30-31H,15H2,1-4H3,(H,29,32)/t18-,19-,20-,21-,22+/m1/s1 |
| InChIKey | DKZXCKDBSQOCRN-LMYCIYFBSA-N |
| XLogP | 1.70 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|