C31H46Cl3NO7Si2 — CID 11399829
2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxyoxan-3-yl]carbamate (PubChem CID 11399829) has the molecular formula C31H46Cl3NO7Si2 and a molecular weight of 707.24 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxyoxan-3-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxyoxan-3-yl]carbamate |
|---|---|
| PubChem CID | 11399829 |
| Molecular Formula | C31H46Cl3NO7Si2 |
| Molecular Weight | 707.24 g/mol |
| Exact Mass | 705.19 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxyoxan-3-yl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C31H46Cl3NO7Si2/c1-29(2,3)43(7,8)42-27-24(35-28(38)39-20-31(32,33)34)26(37)25(36)23(41-27)19-40-44(30(4,5)6,21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9-18,23-27,36-37H,19-20H2,1-8H3,(H,35,38)/t23-,24-,25-,26-,27+/m1/s1 |
| InChIKey | OUMKYWVSBSZWRO-ACFIUOAZSA-N |
| XLogP | 5.50 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.24 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|