C29H38Cl3NO6Si — CID 91408933
2,2,2-trichloroethyl N-[(6S,8R,8aS)-6-[tert-butyl(diphenyl)silyl]oxy-2,2,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate (PubChem CID 91408933) has the molecular formula C29H38Cl3NO6Si and a molecular weight of 631.07 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(6S,8R,8aS)-6-[tert-butyl(diphenyl)silyl]oxy-2,2,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(6S,8R,8aS)-6-[tert-butyl(diphenyl)silyl]oxy-2,2,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
|---|---|
| PubChem CID | 91408933 |
| Molecular Formula | C29H38Cl3NO6Si |
| Molecular Weight | 631.07 g/mol |
| Exact Mass | 629.15 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(6S,8R,8aS)-6-[tert-butyl(diphenyl)silyl]oxy-2,2,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
| SMILES | C[C@@H]1C(NC(=O)OCC(Cl)(Cl)Cl)[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC2COC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C29H38Cl3NO6Si/c1-19-23(33-26(34)35-18-29(30,31)32)25(37-22-17-36-28(5,6)38-24(19)22)39-40(27(2,3)4,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,19,22-25H,17-18H2,1-6H3,(H,33,34)/t19-,22?,23?,24+,25+/m1/s1 |
| InChIKey | QNEWXBISRWEMAW-VEYYBMCUSA-N |
| XLogP | 5.54 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.07 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|