C26H38Cl3NO8Si — CID 131632953
[(2R,4aR,6S,7R,8R,8aS)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-phenyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 131632953) has the molecular formula C26H38Cl3NO8Si and a molecular weight of 627.03 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8R,8aS)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-phenyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(2R,4aR,6S,7R,8R,8aS)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-phenyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 131632953 |
| Molecular Formula | C26H38Cl3NO8Si |
| Molecular Weight | 627.03 g/mol |
| Exact Mass | 625.14 |
| IUPAC Name | [(2R,4aR,6S,7R,8R,8aS)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-phenyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](NC(=O)OCC(Cl)(Cl)Cl)[C@H](O[Si](C)(C)C(C)(C)C(C)C)O[C@@H]2CO[C@@H](c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C26H38Cl3NO8Si/c1-15(2)25(4,5)39(6,7)38-23-19(30-24(32)34-14-26(27,28)29)21(35-16(3)31)20-18(36-23)13-33-22(37-20)17-11-9-8-10-12-17/h8-12,15,18-23H,13-14H2,1-7H3,(H,30,32)/t18-,19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | NPJNJWCHEVSBCR-RCQJKQRMSA-N |
| XLogP | 5.88 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.03 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|