C33H54F3NO6Si4 — CID 102223977
N-[(2S,3R,4R,5R,6R)-2-[tert-butyl(diphenyl)silyl]oxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 102223977) has the molecular formula C33H54F3NO6Si4 and a molecular weight of 730.13 g/mol. Its IUPAC name is N-[(2S,3R,4R,5R,6R)-2-[tert-butyl(diphenyl)silyl]oxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S,3R,4R,5R,6R)-2-[tert-butyl(diphenyl)silyl]oxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 102223977 |
| Molecular Formula | C33H54F3NO6Si4 |
| Molecular Weight | 730.13 g/mol |
| Exact Mass | 729.30 |
| IUPAC Name | N-[(2S,3R,4R,5R,6R)-2-[tert-butyl(diphenyl)silyl]oxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)(C)[Si](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1NC(=O)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H54F3NO6Si4/c1-32(2,3)47(24-19-15-13-16-20-24,25-21-17-14-18-22-25)43-30-27(37-31(38)33(34,35)36)29(42-46(10,11)12)28(41-45(7,8)9)26(40-30)23-39-44(4,5)6/h13-22,26-30H,23H2,1-12H3,(H,37,38)/t26-,27-,28-,29-,30+/m1/s1 |
| InChIKey | MVCDURJAQKZFBC-WYQCABFXSA-N |
| XLogP | 6.63 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.13 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|