C58H71NO7Si3 — CID 11491561
[(1R)-1-[(2S,3R,4R,5S)-4-acetamido-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]oxolan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl] acetate (PubChem CID 11491561) has the molecular formula C58H71NO7Si3 and a molecular weight of 978.46 g/mol. Its IUPAC name is [(1R)-1-[(2S,3R,4R,5S)-4-acetamido-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]oxolan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl] acetate.
| Compound Name | [(1R)-1-[(2S,3R,4R,5S)-4-acetamido-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]oxolan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl] acetate |
|---|---|
| PubChem CID | 11491561 |
| Molecular Formula | C58H71NO7Si3 |
| Molecular Weight | 978.46 g/mol |
| Exact Mass | 977.45 |
| IUPAC Name | [(1R)-1-[(2S,3R,4R,5S)-4-acetamido-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]oxolan-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl] acetate |
| SMILES | CC(=O)N[C@H]1[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H]([C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)=O)[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C58H71NO7Si3/c1-43(60)59-52-54(65-68(57(6,7)8,47-34-22-14-23-35-47)48-36-24-15-25-37-48)53(64-55(52)66-69(58(9,10)11,49-38-26-16-27-39-49)50-40-28-17-29-41-50)51(63-44(2)61)42-62-67(56(3,4)5,45-30-18-12-19-31-45)46-32-20-13-21-33-46/h12-41,51-55H,42H2,1-11H3,(H,59,60)/t51-,52-,53+,54-,55+/m1/s1 |
| InChIKey | KBDDMZWIJWOWBT-UZQUDJGMSA-N |
| XLogP | 8.25 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.46 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|