C33H45NO10Si — CID 71130914
[(3R,6R)-5-acetamido-3,4-diacetyloxy-6-[5-[hydroxy(diphenyl)silyl]-5-methylhexoxy]oxan-2-yl]methyl acetate (PubChem CID 71130914) has the molecular formula C33H45NO10Si and a molecular weight of 643.81 g/mol. Its IUPAC name is [(3R,6R)-5-acetamido-3,4-diacetyloxy-6-[5-[hydroxy(diphenyl)silyl]-5-methylhexoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-5-acetamido-3,4-diacetyloxy-6-[5-[hydroxy(diphenyl)silyl]-5-methylhexoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71130914 |
| Molecular Formula | C33H45NO10Si |
| Molecular Weight | 643.81 g/mol |
| Exact Mass | 643.28 |
| IUPAC Name | [(3R,6R)-5-acetamido-3,4-diacetyloxy-6-[5-[hydroxy(diphenyl)silyl]-5-methylhexoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)NC1C(OC(C)=O)[C@@H](OC(C)=O)C(COC(C)=O)O[C@H]1OCCCCC(C)(C)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H45NO10Si/c1-22(35)34-29-31(43-25(4)38)30(42-24(3)37)28(21-41-23(2)36)44-32(29)40-20-14-13-19-33(5,6)45(39,26-15-9-7-10-16-26)27-17-11-8-12-18-27/h7-12,15-18,28-32,39H,13-14,19-21H2,1-6H3,(H,34,35)/t28?,29?,30-,31?,32+/m0/s1 |
| InChIKey | BTJYLPIKKNNWTQ-PCPFBRFWSA-N |
| XLogP | 2.36 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.81 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|