C39H45F4NO6P2Si — CID 10747860
N-[(2R,3R,4R,5R,6R)-4,5-bis[bis(4-fluorophenyl)phosphanyloxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyoxan-3-yl]acetamide (PubChem CID 10747860) has the molecular formula C39H45F4NO6P2Si and a molecular weight of 789.82 g/mol. Its IUPAC name is N-[(2R,3R,4R,5R,6R)-4,5-bis[bis(4-fluorophenyl)phosphanyloxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyoxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5R,6R)-4,5-bis[bis(4-fluorophenyl)phosphanyloxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 10747860 |
| Molecular Formula | C39H45F4NO6P2Si |
| Molecular Weight | 789.82 g/mol |
| Exact Mass | 789.24 |
| IUPAC Name | N-[(2R,3R,4R,5R,6R)-4,5-bis[bis(4-fluorophenyl)phosphanyloxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyoxan-3-yl]acetamide |
| SMILES | CO[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OP(c2ccc(F)cc2)c2ccc(F)cc2)[C@H](OP(c2ccc(F)cc2)c2ccc(F)cc2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C39H45F4NO6P2Si/c1-25(45)44-35-37(50-52(32-20-12-28(42)13-21-32)33-22-14-29(43)15-23-33)36(34(48-38(35)46-5)24-47-53(6,7)39(2,3)4)49-51(30-16-8-26(40)9-17-30)31-18-10-27(41)11-19-31/h8-23,34-38H,24H2,1-7H3,(H,44,45)/t34-,35-,36-,37-,38-/m1/s1 |
| InChIKey | JTGYRQOEGGMPQZ-OHTWKVNYSA-N |
| XLogP | 7.31 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.82 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|