C47H65NO6P2Si — CID 10986010
N-[(2R,3R,4R,5R,6R)-4,5-bis[bis(3,5-dimethylphenyl)phosphanyloxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyoxan-3-yl]acetamide (PubChem CID 10986010) has the molecular formula C47H65NO6P2Si and a molecular weight of 830.07 g/mol. Its IUPAC name is N-[(2R,3R,4R,5R,6R)-4,5-bis[bis(3,5-dimethylphenyl)phosphanyloxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyoxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5R,6R)-4,5-bis[bis(3,5-dimethylphenyl)phosphanyloxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 10986010 |
| Molecular Formula | C47H65NO6P2Si |
| Molecular Weight | 830.07 g/mol |
| Exact Mass | 829.41 |
| IUPAC Name | N-[(2R,3R,4R,5R,6R)-4,5-bis[bis(3,5-dimethylphenyl)phosphanyloxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyoxan-3-yl]acetamide |
| SMILES | CO[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OP(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)[C@H](OP(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C47H65NO6P2Si/c1-29-16-30(2)21-38(20-29)55(39-22-31(3)17-32(4)23-39)53-44-42(28-51-57(14,15)47(10,11)12)52-46(50-13)43(48-37(9)49)45(44)54-56(40-24-33(5)18-34(6)25-40)41-26-35(7)19-36(8)27-41/h16-27,42-46H,28H2,1-15H3,(H,48,49)/t42-,43-,44-,45-,46-/m1/s1 |
| InChIKey | LRTDQGLHFNXWQO-SXRASJEMSA-N |
| XLogP | 9.22 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.07 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|