C39H49NO6P2Si — CID 10676345
N-[(2R,3R,4R,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(diphenylphosphanyloxy)-2-methoxyoxan-3-yl]acetamide (PubChem CID 10676345) has the molecular formula C39H49NO6P2Si and a molecular weight of 717.86 g/mol. Its IUPAC name is N-[(2R,3R,4R,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(diphenylphosphanyloxy)-2-methoxyoxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(diphenylphosphanyloxy)-2-methoxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 10676345 |
| Molecular Formula | C39H49NO6P2Si |
| Molecular Weight | 717.86 g/mol |
| Exact Mass | 717.28 |
| IUPAC Name | N-[(2R,3R,4R,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(diphenylphosphanyloxy)-2-methoxyoxan-3-yl]acetamide |
| SMILES | CO[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OP(c2ccccc2)c2ccccc2)[C@H](OP(c2ccccc2)c2ccccc2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C39H49NO6P2Si/c1-29(41)40-35-37(46-48(32-24-16-10-17-25-32)33-26-18-11-19-27-33)36(34(44-38(35)42-5)28-43-49(6,7)39(2,3)4)45-47(30-20-12-8-13-21-30)31-22-14-9-15-23-31/h8-27,34-38H,28H2,1-7H3,(H,40,41)/t34-,35-,36-,37-,38-/m1/s1 |
| InChIKey | KHCIPAJDENSHJO-OHTWKVNYSA-N |
| XLogP | 6.75 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.86 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|