C56H69NO6Si3 — CID 11240036
N-[(2S,3R,4R,5R,6R)-2,4-bis[[tert-butyl(diphenyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxan-3-yl]acetamide (PubChem CID 11240036) has the molecular formula C56H69NO6Si3 and a molecular weight of 936.43 g/mol. Its IUPAC name is N-[(2S,3R,4R,5R,6R)-2,4-bis[[tert-butyl(diphenyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4R,5R,6R)-2,4-bis[[tert-butyl(diphenyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 11240036 |
| Molecular Formula | C56H69NO6Si3 |
| Molecular Weight | 936.43 g/mol |
| Exact Mass | 935.44 |
| IUPAC Name | N-[(2S,3R,4R,5R,6R)-2,4-bis[[tert-butyl(diphenyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C56H69NO6Si3/c1-42(58)57-50-52(62-65(55(5,6)7,45-33-21-13-22-34-45)46-35-23-14-24-36-46)51(59)49(41-60-64(54(2,3)4,43-29-17-11-18-30-43)44-31-19-12-20-32-44)61-53(50)63-66(56(8,9)10,47-37-25-15-26-38-47)48-39-27-16-28-40-48/h11-40,49-53,59H,41H2,1-10H3,(H,57,58)/t49-,50-,51-,52-,53+/m1/s1 |
| InChIKey | VAGFYBRALCCQRJ-IXSLWHSPSA-N |
| XLogP | 7.68 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.43 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|