C26H37NO7Si — CID 155766775
N-[(3R,4R,5R,6R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 155766775) has the molecular formula C26H37NO7Si and a molecular weight of 503.67 g/mol. Its IUPAC name is N-[(3R,4R,5R,6R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(3R,4R,5R,6R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 155766775 |
| Molecular Formula | C26H37NO7Si |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | N-[(3R,4R,5R,6R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C(OCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H37NO7Si/c1-18(29)27-22-24(31)23(30)21(17-28)34-25(22)32-15-16-33-35(26(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,21-25,28,30-31H,15-17H2,1-4H3,(H,27,29)/t21-,22-,23+,24-,25?/m1/s1 |
| InChIKey | FQGMWOBVZDPYQV-BIFUOPDKSA-N |
| XLogP | 0.52 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|