C31H39NO6Si — CID 139255575
N-[(2R,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-phenylmethoxyoxan-3-yl]acetamide (PubChem CID 139255575) has the molecular formula C31H39NO6Si and a molecular weight of 549.74 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-phenylmethoxyoxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-phenylmethoxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 139255575 |
| Molecular Formula | C31H39NO6Si |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-phenylmethoxyoxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H](OCc2ccccc2)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C31H39NO6Si/c1-22(33)32-27-29(35)28(34)26(38-30(27)36-20-23-14-8-5-9-15-23)21-37-39(31(2,3)4,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,26-30,34-35H,20-21H2,1-4H3,(H,32,33)/t26-,27-,28-,29-,30-/m1/s1 |
| InChIKey | XJNIEFIQULOLNK-XZTOTZIXSA-N |
| XLogP | 2.73 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|