C35H52F3NO5Si2 — CID 14354597
N-[(E,1R,4S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]-2,2,2-trifluoroacetamide (PubChem CID 14354597) has the molecular formula C35H52F3NO5Si2 and a molecular weight of 679.97 g/mol. Its IUPAC name is N-[(E,1R,4S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(E,1R,4S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 14354597 |
| Molecular Formula | C35H52F3NO5Si2 |
| Molecular Weight | 679.97 g/mol |
| Exact Mass | 679.33 |
| IUPAC Name | N-[(E,1R,4S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@@H](/C=C/[C@@H](NC(=O)C(F)(F)F)[C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H52F3NO5Si2/c1-25(44-46(33(5,6)7,26-18-14-12-15-19-26)27-20-16-13-17-21-27)22-23-28(39-31(40)35(36,37)38)30-29(42-34(8,9)43-30)24-41-45(10,11)32(2,3)4/h12-23,25,28-30H,24H2,1-11H3,(H,39,40)/b23-22+/t25-,28+,29-,30-/m0/s1 |
| InChIKey | MBCQSRJOBGEJTM-DRVXNFOLSA-N |
| XLogP | 7.10 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.97 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|