C27H42F3NO6Si — CID 10626719
N-[(E,1R,4R)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(phenylmethoxymethoxy)pent-2-enyl]-2,2,2-trifluoroacetamide (PubChem CID 10626719) has the molecular formula C27H42F3NO6Si and a molecular weight of 561.71 g/mol. Its IUPAC name is N-[(E,1R,4R)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(phenylmethoxymethoxy)pent-2-enyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(E,1R,4R)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(phenylmethoxymethoxy)pent-2-enyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 10626719 |
| Molecular Formula | C27H42F3NO6Si |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | N-[(E,1R,4R)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(phenylmethoxymethoxy)pent-2-enyl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@H](/C=C/[C@@H](NC(=O)C(F)(F)F)[C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C)OCOCc1ccccc1 |
| InChI | InChI=1S/C27H42F3NO6Si/c1-19(34-18-33-16-20-12-10-9-11-13-20)14-15-21(31-24(32)27(28,29)30)23-22(36-26(5,6)37-23)17-35-38(7,8)25(2,3)4/h9-15,19,21-23H,16-18H2,1-8H3,(H,31,32)/b15-14+/t19-,21-,22+,23+/m1/s1 |
| InChIKey | CVHJRFSFQNBUKZ-WJHUBRFNSA-N |
| XLogP | 5.71 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|