C21H24F3NO9 — CID 4278278
[3,5-diacetyloxy-6-phenylmethoxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate (PubChem CID 4278278) has the molecular formula C21H24F3NO9 and a molecular weight of 491.42 g/mol. Its IUPAC name is [3,5-diacetyloxy-6-phenylmethoxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [3,5-diacetyloxy-6-phenylmethoxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 4278278 |
| Molecular Formula | C21H24F3NO9 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | [3,5-diacetyloxy-6-phenylmethoxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OCc2ccccc2)C(OC(C)=O)C(NC(=O)C(F)(F)F)C1OC(C)=O |
| InChI | InChI=1S/C21H24F3NO9/c1-11(26)30-10-15-17(32-12(2)27)16(25-20(29)21(22,23)24)18(33-13(3)28)19(34-15)31-9-14-7-5-4-6-8-14/h4-8,15-19H,9-10H2,1-3H3,(H,25,29) |
| InChIKey | VINHSFCPOKEYLJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|