C21H32F3NO4Si — CID 10694733
N-[(2S,3R,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylmethoxyoxan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 10694733) has the molecular formula C21H32F3NO4Si and a molecular weight of 447.57 g/mol. Its IUPAC name is N-[(2S,3R,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylmethoxyoxan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S,3R,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylmethoxyoxan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 10694733 |
| Molecular Formula | C21H32F3NO4Si |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-[(2S,3R,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylmethoxyoxan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@@H]1O[C@H](O[Si](C)(C)C(C)(C)C)C[C@H](NC(=O)C(F)(F)F)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H32F3NO4Si/c1-14-18(27-13-15-10-8-7-9-11-15)16(25-19(26)21(22,23)24)12-17(28-14)29-30(5,6)20(2,3)4/h7-11,14,16-18H,12-13H2,1-6H3,(H,25,26)/t14-,16-,17+,18-/m0/s1 |
| InChIKey | CGJGLJFNUUXEIC-OWLYRPNTSA-N |
| XLogP | 4.78 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|