C17H22F3NO4 — CID 57202441
N-[(2R,3R,4S,6S)-3-benzyl-3,6-dimethoxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 57202441) has the molecular formula C17H22F3NO4 and a molecular weight of 361.36 g/mol. Its IUPAC name is N-[(2R,3R,4S,6S)-3-benzyl-3,6-dimethoxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2R,3R,4S,6S)-3-benzyl-3,6-dimethoxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 57202441 |
| Molecular Formula | C17H22F3NO4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[(2R,3R,4S,6S)-3-benzyl-3,6-dimethoxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | CO[C@@H]1C[C@H](NC(=O)C(F)(F)F)[C@@](Cc2ccccc2)(OC)[C@@H](C)O1 |
| InChI | InChI=1S/C17H22F3NO4/c1-11-16(24-3,10-12-7-5-4-6-8-12)13(9-14(23-2)25-11)21-15(22)17(18,19)20/h4-8,11,13-14H,9-10H2,1-3H3,(H,21,22)/t11-,13+,14+,16+/m1/s1 |
| InChIKey | BLKKZIFQTUATMC-DSRCVFDASA-N |
| XLogP | 2.44 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |