C17H22F3NO4 — CID 135018708
2,2,2-trifluoro-N-[(3S,4R,6S)-6-methoxy-2,4-dimethyl-3-phenylmethoxyoxan-4-yl]acetamide (PubChem CID 135018708) has the molecular formula C17H22F3NO4 and a molecular weight of 361.36 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3S,4R,6S)-6-methoxy-2,4-dimethyl-3-phenylmethoxyoxan-4-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(3S,4R,6S)-6-methoxy-2,4-dimethyl-3-phenylmethoxyoxan-4-yl]acetamide |
|---|---|
| PubChem CID | 135018708 |
| Molecular Formula | C17H22F3NO4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3S,4R,6S)-6-methoxy-2,4-dimethyl-3-phenylmethoxyoxan-4-yl]acetamide |
| SMILES | CO[C@@H]1C[C@@](C)(NC(=O)C(F)(F)F)[C@H](OCc2ccccc2)C(C)O1 |
| InChI | InChI=1S/C17H22F3NO4/c1-11-14(24-10-12-7-5-4-6-8-12)16(2,9-13(23-3)25-11)21-15(22)17(18,19)20/h4-8,11,13-14H,9-10H2,1-3H3,(H,21,22)/t11?,13-,14+,16+/m0/s1 |
| InChIKey | SIBHWSJAHDQJMZ-QYEAHEDKSA-N |
| XLogP | 2.79 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |