C33H53NO4Si2 — CID 14354600
(E,1R,4S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[tert-butyl(diphenyl)silyl]oxypent-2-en-1-amine (PubChem CID 14354600) has the molecular formula C33H53NO4Si2 and a molecular weight of 583.96 g/mol. Its IUPAC name is (E,1R,4S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[tert-butyl(diphenyl)silyl]oxypent-2-en-1-amine.
| Compound Name | (E,1R,4S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[tert-butyl(diphenyl)silyl]oxypent-2-en-1-amine |
|---|---|
| PubChem CID | 14354600 |
| Molecular Formula | C33H53NO4Si2 |
| Molecular Weight | 583.96 g/mol |
| Exact Mass | 583.35 |
| IUPAC Name | (E,1R,4S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[tert-butyl(diphenyl)silyl]oxypent-2-en-1-amine |
| SMILES | C[C@@H](/C=C/[C@@H](N)[C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H53NO4Si2/c1-25(38-40(32(5,6)7,26-18-14-12-15-19-26)27-20-16-13-17-21-27)22-23-28(34)30-29(36-33(8,9)37-30)24-35-39(10,11)31(2,3)4/h12-23,25,28-30H,24,34H2,1-11H3/b23-22+/t25-,28+,29-,30-/m0/s1 |
| InChIKey | TZHJFWWGHZRNTP-DRVXNFOLSA-N |
| XLogP | 6.38 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.96 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|