C38H61NO6Si2 — CID 14354602
tert-butyl N-[(E,1R,4S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]carbamate (PubChem CID 14354602) has the molecular formula C38H61NO6Si2 and a molecular weight of 684.08 g/mol. Its IUPAC name is tert-butyl N-[(E,1R,4S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E,1R,4S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]carbamate |
|---|---|
| PubChem CID | 14354602 |
| Molecular Formula | C38H61NO6Si2 |
| Molecular Weight | 684.08 g/mol |
| Exact Mass | 683.40 |
| IUPAC Name | tert-butyl N-[(E,1R,4S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]carbamate |
| SMILES | C[C@@H](/C=C/[C@@H](NC(=O)OC(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C38H61NO6Si2/c1-28(45-47(37(8,9)10,29-21-17-15-18-22-29)30-23-19-16-20-24-30)25-26-31(39-34(40)44-35(2,3)4)33-32(42-38(11,12)43-33)27-41-46(13,14)36(5,6)7/h15-26,28,31-33H,27H2,1-14H3,(H,39,40)/b26-25+/t28-,31+,32-,33-/m0/s1 |
| InChIKey | PLQRJKIHOQYZCQ-HVZKQATRSA-N |
| XLogP | 7.94 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.08 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|