C28H37NO4Si — CID 11329094
tert-butyl-[[(4R,5R)-5-[(E,1S)-1-isocyanatopent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane (PubChem CID 11329094) has the molecular formula C28H37NO4Si and a molecular weight of 479.69 g/mol. Its IUPAC name is tert-butyl-[[(4R,5R)-5-[(E,1S)-1-isocyanatopent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(4R,5R)-5-[(E,1S)-1-isocyanatopent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11329094 |
| Molecular Formula | C28H37NO4Si |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | tert-butyl-[[(4R,5R)-5-[(E,1S)-1-isocyanatopent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane |
| SMILES | CC/C=C/[C@H](N=C=O)[C@H]1OC(C)(C)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H37NO4Si/c1-7-8-19-24(29-21-30)26-25(32-28(5,6)33-26)20-31-34(27(2,3)4,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h8-19,24-26H,7,20H2,1-6H3/b19-8+/t24-,25+,26+/m0/s1 |
| InChIKey | QFDNOOCNMQNJSV-QHTGJCAWSA-N |
| XLogP | 4.75 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|