C31H48N2O5Si — CID 57295399
[(3S,4S,5R,6R)-1-butyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidin-3-yl] N-butylcarbamate (PubChem CID 57295399) has the molecular formula C31H48N2O5Si and a molecular weight of 556.82 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-1-butyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidin-3-yl] N-butylcarbamate.
| Compound Name | [(3S,4S,5R,6R)-1-butyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidin-3-yl] N-butylcarbamate |
|---|---|
| PubChem CID | 57295399 |
| Molecular Formula | C31H48N2O5Si |
| Molecular Weight | 556.82 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | [(3S,4S,5R,6R)-1-butyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidin-3-yl] N-butylcarbamate |
| SMILES | CCCCNC(=O)O[C@H]1CN(CCCC)[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C31H48N2O5Si/c1-6-8-20-32-30(36)38-27-22-33(21-9-7-2)26(28(34)29(27)35)23-37-39(31(3,4)5,24-16-12-10-13-17-24)25-18-14-11-15-19-25/h10-19,26-29,34-35H,6-9,20-23H2,1-5H3,(H,32,36)/t26-,27+,28-,29-/m1/s1 |
| InChIKey | WLTQYCWNWLPTIV-VJLHXPKFSA-N |
| XLogP | 3.66 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.82 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|