C27H39NO6Si — CID 102450333
tert-butyl N-[(1S,2S,3S,4S,6S)-2-[tert-butyl(diphenyl)silyl]oxy-3,4,6-trihydroxycyclohexyl]carbamate (PubChem CID 102450333) has the molecular formula C27H39NO6Si and a molecular weight of 501.70 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S,3S,4S,6S)-2-[tert-butyl(diphenyl)silyl]oxy-3,4,6-trihydroxycyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S,3S,4S,6S)-2-[tert-butyl(diphenyl)silyl]oxy-3,4,6-trihydroxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 102450333 |
| Molecular Formula | C27H39NO6Si |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | tert-butyl N-[(1S,2S,3S,4S,6S)-2-[tert-butyl(diphenyl)silyl]oxy-3,4,6-trihydroxycyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C27H39NO6Si/c1-26(2,3)33-25(32)28-22-20(29)17-21(30)23(31)24(22)34-35(27(4,5)6,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-16,20-24,29-31H,17H2,1-6H3,(H,28,32)/t20-,21-,22-,23-,24-/m0/s1 |
| InChIKey | FLBXYVYTAYDMCD-LSBAASHUSA-N |
| XLogP | 2.31 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|