C31H47NO6Si — CID 57165871
[(3S,4S,5R,6R)-1-butyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidin-3-yl] 2-methylpropyl carbonate (PubChem CID 57165871) has the molecular formula C31H47NO6Si and a molecular weight of 557.80 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-1-butyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidin-3-yl] 2-methylpropyl carbonate.
| Compound Name | [(3S,4S,5R,6R)-1-butyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidin-3-yl] 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 57165871 |
| Molecular Formula | C31H47NO6Si |
| Molecular Weight | 557.80 g/mol |
| Exact Mass | 557.32 |
| IUPAC Name | [(3S,4S,5R,6R)-1-butyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidin-3-yl] 2-methylpropyl carbonate |
| SMILES | CCCCN1C[C@H](OC(=O)OCC(C)C)[C@@H](O)[C@H](O)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H47NO6Si/c1-7-8-19-32-20-27(38-30(35)36-21-23(2)3)29(34)28(33)26(32)22-37-39(31(4,5)6,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-18,23,26-29,33-34H,7-8,19-22H2,1-6H3/t26-,27+,28-,29-/m1/s1 |
| InChIKey | QBCKHLAJMVKFIJ-VJLHXPKFSA-N |
| XLogP | 3.95 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.80 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|