C25H35N3O5Si — CID 59765608
(3R,4R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethoxy-3-methoxyoxan-4-ol (PubChem CID 59765608) has the molecular formula C25H35N3O5Si and a molecular weight of 485.66 g/mol. Its IUPAC name is (3R,4R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethoxy-3-methoxyoxan-4-ol.
| Compound Name | (3R,4R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethoxy-3-methoxyoxan-4-ol |
|---|---|
| PubChem CID | 59765608 |
| Molecular Formula | C25H35N3O5Si |
| Molecular Weight | 485.66 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | (3R,4R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethoxy-3-methoxyoxan-4-ol |
| SMILES | CCOC1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](OC)[C@H](O)C1N=[N+]=[N-] |
| InChI | InChI=1S/C25H35N3O5Si/c1-6-31-24-21(27-28-26)22(29)23(30-5)20(33-24)17-32-34(25(2,3)4,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-16,20-24,29H,6,17H2,1-5H3/t20?,21?,22-,23+,24?/m1/s1 |
| InChIKey | IMYCMFOHDKYSBG-BRBRSKPPSA-N |
| XLogP | 3.38 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.66 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|