C22H31N3O4Si — CID 10387948
(2S,3S)-3-azido-4-[tert-butyl(diphenyl)silyl]oxy-1,1-dimethoxybutan-2-ol (PubChem CID 10387948) has the molecular formula C22H31N3O4Si and a molecular weight of 429.59 g/mol. Its IUPAC name is (2S,3S)-3-azido-4-[tert-butyl(diphenyl)silyl]oxy-1,1-dimethoxybutan-2-ol.
| Compound Name | (2S,3S)-3-azido-4-[tert-butyl(diphenyl)silyl]oxy-1,1-dimethoxybutan-2-ol |
|---|---|
| PubChem CID | 10387948 |
| Molecular Formula | C22H31N3O4Si |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (2S,3S)-3-azido-4-[tert-butyl(diphenyl)silyl]oxy-1,1-dimethoxybutan-2-ol |
| SMILES | COC(OC)[C@@H](O)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N=[N+]=[N-] |
| InChI | InChI=1S/C22H31N3O4Si/c1-22(2,3)30(17-12-8-6-9-13-17,18-14-10-7-11-15-18)29-16-19(24-25-23)20(26)21(27-4)28-5/h6-15,19-21,26H,16H2,1-5H3/t19-,20-/m0/s1 |
| InChIKey | KRNZUHAUPSQCHA-PMACEKPBSA-N |
| XLogP | 3.22 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|