C21H27N3O4Si — CID 57266863
(2S,4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxy-hydroxymethyl]oxolan-2-ol (PubChem CID 57266863) has the molecular formula C21H27N3O4Si and a molecular weight of 413.55 g/mol. Its IUPAC name is (2S,4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxy-hydroxymethyl]oxolan-2-ol.
| Compound Name | (2S,4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxy-hydroxymethyl]oxolan-2-ol |
|---|---|
| PubChem CID | 57266863 |
| Molecular Formula | C21H27N3O4Si |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (2S,4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxy-hydroxymethyl]oxolan-2-ol |
| SMILES | CC(C)(C)[Si](OC(O)[C@H]1O[C@H](O)C[C@@H]1N=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27N3O4Si/c1-21(2,3)29(15-10-6-4-7-11-15,16-12-8-5-9-13-16)28-20(26)19-17(23-24-22)14-18(25)27-19/h4-13,17-20,25-26H,14H2,1-3H3/t17-,18-,19-,20?/m0/s1 |
| InChIKey | OUDXBAUYYVIUIT-TWQWKPIESA-N |
| XLogP | 2.67 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|