C22H27N3O4Si — CID 59624121
(2R,3S,5S)-4-azido-2-[tert-butyl(diphenyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 59624121) has the molecular formula C22H27N3O4Si and a molecular weight of 425.56 g/mol. Its IUPAC name is (2R,3S,5S)-4-azido-2-[tert-butyl(diphenyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (2R,3S,5S)-4-azido-2-[tert-butyl(diphenyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 59624121 |
| Molecular Formula | C22H27N3O4Si |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (2R,3S,5S)-4-azido-2-[tert-butyl(diphenyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | CC(C)(C)[Si](O[C@H]1C2CO[C@@H](O2)C(N=[N+]=[N-])[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O4Si/c1-22(2,3)30(15-10-6-4-7-11-15,16-12-8-5-9-13-16)29-20-17-14-27-21(28-17)18(19(20)26)24-25-23/h4-13,17-21,26H,14H2,1-3H3/t17?,18?,19-,20-,21-/m0/s1 |
| InChIKey | CSPYLFZFGRJTMU-IMPXWGQXSA-N |
| XLogP | 2.73 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|