C24H29N3O5Si — CID 59624115
[(2R,3S,5S)-4-azido-2-[tert-butyl(diphenyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate (PubChem CID 59624115) has the molecular formula C24H29N3O5Si and a molecular weight of 467.60 g/mol. Its IUPAC name is [(2R,3S,5S)-4-azido-2-[tert-butyl(diphenyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate.
| Compound Name | [(2R,3S,5S)-4-azido-2-[tert-butyl(diphenyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate |
|---|---|
| PubChem CID | 59624115 |
| Molecular Formula | C24H29N3O5Si |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | [(2R,3S,5S)-4-azido-2-[tert-butyl(diphenyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(N=[N+]=[N-])[C@H]2OCC(O2)[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H29N3O5Si/c1-16(28)30-22-20(26-27-25)23-29-15-19(31-23)21(22)32-33(24(2,3)4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19-23H,15H2,1-4H3/t19?,20?,21-,22-,23-/m0/s1 |
| InChIKey | HVUWYUCIOUCEMM-VMIXUHJNSA-N |
| XLogP | 3.30 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|