C30H37N3O15Se — CID 134837586
[(2S,3S,6S)-3,4,5-triacetyloxy-6-[(3S,6R)-4-acetyloxy-2-(acetyloxymethyl)-5-azido-6-phenylselanyloxan-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 134837586) has the molecular formula C30H37N3O15Se and a molecular weight of 758.59 g/mol. Its IUPAC name is [(2S,3S,6S)-3,4,5-triacetyloxy-6-[(3S,6R)-4-acetyloxy-2-(acetyloxymethyl)-5-azido-6-phenylselanyloxan-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,6S)-3,4,5-triacetyloxy-6-[(3S,6R)-4-acetyloxy-2-(acetyloxymethyl)-5-azido-6-phenylselanyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134837586 |
| Molecular Formula | C30H37N3O15Se |
| Molecular Weight | 758.59 g/mol |
| Exact Mass | 759.14 |
| IUPAC Name | [(2S,3S,6S)-3,4,5-triacetyloxy-6-[(3S,6R)-4-acetyloxy-2-(acetyloxymethyl)-5-azido-6-phenylselanyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H]([Se]c2ccccc2)C(N=[N+]=[N-])C(OC(C)=O)[C@@H]1O[C@@H]1O[C@@H](COC(C)=O)[C@H](OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C30H37N3O15Se/c1-14(34)40-12-21-25(42-16(3)36)27(44-18(5)38)28(45-19(6)39)29(46-21)48-24-22(13-41-15(2)35)47-30(49-20-10-8-7-9-11-20)23(32-33-31)26(24)43-17(4)37/h7-11,21-30H,12-13H2,1-6H3/t21-,22?,23?,24+,25-,26?,27?,28?,29-,30+/m0/s1 |
| InChIKey | IJLAXKQHTZBDPX-CYMOZVRBSA-N |
| XLogP | 0.38 |
| TPSA | 234.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.59 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|