C16H19N3O5Se — CID 134864121
[(3S,6R)-4-acetyloxy-5-azido-2-methyl-6-phenylselanyloxan-3-yl] acetate (PubChem CID 134864121) has the molecular formula C16H19N3O5Se and a molecular weight of 412.30 g/mol. Its IUPAC name is [(3S,6R)-4-acetyloxy-5-azido-2-methyl-6-phenylselanyloxan-3-yl] acetate.
| Compound Name | [(3S,6R)-4-acetyloxy-5-azido-2-methyl-6-phenylselanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 134864121 |
| Molecular Formula | C16H19N3O5Se |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | [(3S,6R)-4-acetyloxy-5-azido-2-methyl-6-phenylselanyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(N=[N+]=[N-])[C@@H]([Se]c2ccccc2)OC(C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H19N3O5Se/c1-9-14(23-10(2)20)15(24-11(3)21)13(18-19-17)16(22-9)25-12-7-5-4-6-8-12/h4-9,13-16H,1-3H3/t9?,13?,14-,15?,16+/m0/s1 |
| InChIKey | JJIMSBWPYSDNTP-MCNDVTJJSA-N |
| XLogP | 1.30 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|