C15H21N3O4Se — CID 10861980
(2R,3S,4R,5R,6R)-5-azido-3,4-dimethoxy-2-(methoxymethyl)-6-phenylselanyloxane (PubChem CID 10861980) has the molecular formula C15H21N3O4Se and a molecular weight of 386.31 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-5-azido-3,4-dimethoxy-2-(methoxymethyl)-6-phenylselanyloxane.
| Compound Name | (2R,3S,4R,5R,6R)-5-azido-3,4-dimethoxy-2-(methoxymethyl)-6-phenylselanyloxane |
|---|---|
| PubChem CID | 10861980 |
| Molecular Formula | C15H21N3O4Se |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | (2R,3S,4R,5R,6R)-5-azido-3,4-dimethoxy-2-(methoxymethyl)-6-phenylselanyloxane |
| SMILES | COC[C@H]1O[C@H]([Se]c2ccccc2)[C@H](N=[N+]=[N-])[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C15H21N3O4Se/c1-19-9-11-13(20-2)14(21-3)12(17-18-16)15(22-11)23-10-7-5-4-6-8-10/h4-8,11-15H,9H2,1-3H3/t11-,12-,13-,14-,15-/m1/s1 |
| InChIKey | RSBCEYAMJGTQII-KJWHEZOQSA-N |
| XLogP | 1.10 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|