C12H15N3O4Se — CID 167993277
(2R,3S,4R,5S,6R)-5-azido-2-(hydroxymethyl)-6-phenylselanyloxane-3,4-diol (PubChem CID 167993277) has the molecular formula C12H15N3O4Se and a molecular weight of 344.23 g/mol. Its IUPAC name is (2R,3S,4R,5S,6R)-5-azido-2-(hydroxymethyl)-6-phenylselanyloxane-3,4-diol.
| Compound Name | (2R,3S,4R,5S,6R)-5-azido-2-(hydroxymethyl)-6-phenylselanyloxane-3,4-diol |
|---|---|
| PubChem CID | 167993277 |
| Molecular Formula | C12H15N3O4Se |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | (2R,3S,4R,5S,6R)-5-azido-2-(hydroxymethyl)-6-phenylselanyloxane-3,4-diol |
| SMILES | [N-]=[N+]=N[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C12H15N3O4Se/c13-15-14-9-11(18)10(17)8(6-16)19-12(9)20-7-4-2-1-3-5-7/h1-5,8-12,16-18H,6H2/t8-,9+,10-,11-,12-/m1/s1 |
| InChIKey | BVCCVYTUANZCSY-IYKVGLELSA-N |
| XLogP | -0.87 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|