C30H39NO15Se — CID 134837587
[(2S,3S,6S)-3,4,5-triacetyloxy-6-[(3S,6R)-4-acetyloxy-2-(acetyloxymethyl)-5-amino-6-phenylselanyloxan-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 134837587) has the molecular formula C30H39NO15Se and a molecular weight of 732.59 g/mol. Its IUPAC name is [(2S,3S,6S)-3,4,5-triacetyloxy-6-[(3S,6R)-4-acetyloxy-2-(acetyloxymethyl)-5-amino-6-phenylselanyloxan-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,6S)-3,4,5-triacetyloxy-6-[(3S,6R)-4-acetyloxy-2-(acetyloxymethyl)-5-amino-6-phenylselanyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134837587 |
| Molecular Formula | C30H39NO15Se |
| Molecular Weight | 732.59 g/mol |
| Exact Mass | 733.15 |
| IUPAC Name | [(2S,3S,6S)-3,4,5-triacetyloxy-6-[(3S,6R)-4-acetyloxy-2-(acetyloxymethyl)-5-amino-6-phenylselanyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H]([Se]c2ccccc2)C(N)C(OC(C)=O)[C@@H]1O[C@@H]1O[C@@H](COC(C)=O)[C@H](OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C30H39NO15Se/c1-14(32)38-12-21-25(40-16(3)34)27(42-18(5)36)28(43-19(6)37)29(44-21)46-24-22(13-39-15(2)33)45-30(23(31)26(24)41-17(4)35)47-20-10-8-7-9-11-20/h7-11,21-30H,12-13,31H2,1-6H3/t21-,22?,23?,24+,25-,26?,27?,28?,29-,30+/m0/s1 |
| InChIKey | LTKUMDAFEMAIDD-CYMOZVRBSA-N |
| XLogP | -0.97 |
| TPSA | 211.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.59 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|