C18H23NO7Se — CID 10456109
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-amino-6-phenylselanyloxan-2-yl]methyl acetate (PubChem CID 10456109) has the molecular formula C18H23NO7Se and a molecular weight of 444.34 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-amino-6-phenylselanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-amino-6-phenylselanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10456109 |
| Molecular Formula | C18H23NO7Se |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-amino-6-phenylselanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H]([Se]c2ccccc2)[C@H](N)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H23NO7Se/c1-10(20)23-9-14-16(24-11(2)21)17(25-12(3)22)15(19)18(26-14)27-13-7-5-4-6-8-13/h4-8,14-18H,9,19H2,1-3H3/t14-,15-,16-,17-,18-/m1/s1 |
| InChIKey | KRGLJLUBYKFVKT-DUQPFJRNSA-N |
| XLogP | -0.51 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|