C23H31NO9Se — CID 101090800
[(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylselanyloxan-2-yl]methyl acetate (PubChem CID 101090800) has the molecular formula C23H31NO9Se and a molecular weight of 544.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylselanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylselanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101090800 |
| Molecular Formula | C23H31NO9Se |
| Molecular Weight | 544.46 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylselanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H]([Se]c2ccccc2)[C@H](NC(=O)OC(C)(C)C)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H31NO9Se/c1-13(25)29-12-17-19(30-14(2)26)20(31-15(3)27)18(24-22(28)33-23(4,5)6)21(32-17)34-16-10-8-7-9-11-16/h7-11,17-21H,12H2,1-6H3,(H,24,28)/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | IVRXJGUZYBNBPO-YMQHIKHWSA-N |
| XLogP | 1.06 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.46 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|