C20H25NO8SSe — CID 58969208
(5-acetamido-3,4-diacetyloxy-6-phenylselanylsulfanyloxan-2-yl)methyl acetate (PubChem CID 58969208) has the molecular formula C20H25NO8SSe and a molecular weight of 518.45 g/mol. Its IUPAC name is (5-acetamido-3,4-diacetyloxy-6-phenylselanylsulfanyloxan-2-yl)methyl acetate.
| Compound Name | (5-acetamido-3,4-diacetyloxy-6-phenylselanylsulfanyloxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 58969208 |
| Molecular Formula | C20H25NO8SSe |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | (5-acetamido-3,4-diacetyloxy-6-phenylselanylsulfanyloxan-2-yl)methyl acetate |
| SMILES | CC(=O)NC1C(S[Se]c2ccccc2)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C20H25NO8SSe/c1-11(22)21-17-19(28-14(4)25)18(27-13(3)24)16(10-26-12(2)23)29-20(17)30-31-15-8-6-5-7-9-15/h5-9,16-20H,10H2,1-4H3,(H,21,22) |
| InChIKey | FVFSFVCXTDNUDA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|