C23H34N2O9 — CID 90855323
2-(4-methylphenyl)ethanamine;(3,4,6-triacetyloxy-5-aminooxan-2-yl)methyl acetate (PubChem CID 90855323) has the molecular formula C23H34N2O9 and a molecular weight of 482.53 g/mol. Its IUPAC name is 2-(4-methylphenyl)ethanamine;(3,4,6-triacetyloxy-5-aminooxan-2-yl)methyl acetate.
| Compound Name | 2-(4-methylphenyl)ethanamine;(3,4,6-triacetyloxy-5-aminooxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 90855323 |
| Molecular Formula | C23H34N2O9 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 2-(4-methylphenyl)ethanamine;(3,4,6-triacetyloxy-5-aminooxan-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)=O)C(N)C(OC(C)=O)C1OC(C)=O.Cc1ccc(CCN)cc1 |
| InChI | InChI=1S/C14H21NO9.C9H13N/c1-6(16)20-5-10-12(21-7(2)17)13(22-8(3)18)11(15)14(24-10)23-9(4)19;1-8-2-4-9(5-3-8)6-7-10/h10-14H,5,15H2,1-4H3;2-5H,6-7,10H2,1H3 |
| InChIKey | YWIYTSRSRUGCJX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 166.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|