C19H25NO8 — CID 123730194
(3,4-diacetyloxy-5-amino-6-phenylmethoxyoxan-2-yl)methyl acetate (PubChem CID 123730194) has the molecular formula C19H25NO8 and a molecular weight of 395.41 g/mol. Its IUPAC name is (3,4-diacetyloxy-5-amino-6-phenylmethoxyoxan-2-yl)methyl acetate.
| Compound Name | (3,4-diacetyloxy-5-amino-6-phenylmethoxyoxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 123730194 |
| Molecular Formula | C19H25NO8 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (3,4-diacetyloxy-5-amino-6-phenylmethoxyoxan-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(OCc2ccccc2)C(N)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H25NO8/c1-11(21)24-10-15-17(26-12(2)22)18(27-13(3)23)16(20)19(28-15)25-9-14-7-5-4-6-8-14/h4-8,15-19H,9-10,20H2,1-3H3 |
| InChIKey | MCYUIGUTXUJVBV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|