C38H55NO15Se — CID 101470520
[(2R,3S,4S,5R,6R)-6-[(2R,3R,4R,5S,6S)-3-acetamido-5-acetyloxy-2-octoxy-6-(phenylselanylmethyl)oxan-4-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 101470520) has the molecular formula C38H55NO15Se and a molecular weight of 844.81 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[(2R,3R,4R,5S,6S)-3-acetamido-5-acetyloxy-2-octoxy-6-(phenylselanylmethyl)oxan-4-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[(2R,3R,4R,5S,6S)-3-acetamido-5-acetyloxy-2-octoxy-6-(phenylselanylmethyl)oxan-4-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101470520 |
| Molecular Formula | C38H55NO15Se |
| Molecular Weight | 844.81 g/mol |
| Exact Mass | 845.27 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[(2R,3R,4R,5S,6S)-3-acetamido-5-acetyloxy-2-octoxy-6-(phenylselanylmethyl)oxan-4-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CCCCCCCCO[C@@H]1O[C@H](C[Se]c2ccccc2)[C@@H](OC(C)=O)[C@H](O[C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C38H55NO15Se/c1-8-9-10-11-12-16-19-46-37-31(39-22(2)40)34(33(49-25(5)43)30(53-37)21-55-28-17-14-13-15-18-28)54-38-36(51-27(7)45)35(50-26(6)44)32(48-24(4)42)29(52-38)20-47-23(3)41/h13-15,17-18,29-38H,8-12,16,19-21H2,1-7H3,(H,39,40)/t29-,30-,31-,32+,33-,34-,35+,36-,37-,38+/m1/s1 |
| InChIKey | SKLMNSRIHSPKDD-ZEBPYUATSA-N |
| XLogP | 2.44 |
| TPSA | 197.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.81 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|