C32H41NO16Se — CID 101224280
[(2R,3S,4S,5R,6S)-6-[(2R,3S,4R,5S,6R)-5-acetamido-4-acetyloxy-2-(acetyloxymethyl)-6-phenylselanyloxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 101224280) has the molecular formula C32H41NO16Se and a molecular weight of 774.63 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[(2R,3S,4R,5S,6R)-5-acetamido-4-acetyloxy-2-(acetyloxymethyl)-6-phenylselanyloxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[(2R,3S,4R,5S,6R)-5-acetamido-4-acetyloxy-2-(acetyloxymethyl)-6-phenylselanyloxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101224280 |
| Molecular Formula | C32H41NO16Se |
| Molecular Weight | 774.63 g/mol |
| Exact Mass | 775.16 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[(2R,3S,4R,5S,6R)-5-acetamido-4-acetyloxy-2-(acetyloxymethyl)-6-phenylselanyloxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@@H](OC(C)=O)[C@H](O[C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@@H](COC(C)=O)O[C@@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C32H41NO16Se/c1-15(34)33-25-28(44-19(5)38)26(24(14-42-17(3)36)48-32(25)50-22-11-9-8-10-12-22)49-31-30(46-21(7)40)29(45-20(6)39)27(43-18(4)37)23(47-31)13-41-16(2)35/h8-12,23-32H,13-14H2,1-7H3,(H,33,34)/t23-,24-,25+,26-,27+,28-,29+,30-,31+,32-/m1/s1 |
| InChIKey | KMYKECGWRRRJSD-RALVUIQHSA-N |
| XLogP | -0.79 |
| TPSA | 214.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.63 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|