C28H34Cl3N7O11Se — CID 158864429
(4-acetyloxy-5-azido-2-methyl-6-phenylselanyloxan-3-yl) acetate;[4-acetyloxy-5-azido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (PubChem CID 158864429) has the molecular formula C28H34Cl3N7O11Se and a molecular weight of 829.94 g/mol. Its IUPAC name is (4-acetyloxy-5-azido-2-methyl-6-phenylselanyloxan-3-yl) acetate;[4-acetyloxy-5-azido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate.
| Compound Name | (4-acetyloxy-5-azido-2-methyl-6-phenylselanyloxan-3-yl) acetate;[4-acetyloxy-5-azido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 158864429 |
| Molecular Formula | C28H34Cl3N7O11Se |
| Molecular Weight | 829.94 g/mol |
| Exact Mass | 829.05 |
| IUPAC Name | (4-acetyloxy-5-azido-2-methyl-6-phenylselanyloxan-3-yl) acetate;[4-acetyloxy-5-azido-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(C)OC([Se]c2ccccc2)C(N=[N+]=[N-])C1OC(C)=O.[H]/N=C(/OC1OC(C)C(OC(C)=O)C(OC(C)=O)C1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H19N3O5Se.C12H15Cl3N4O6/c1-9-14(23-10(2)20)15(24-11(3)21)13(18-19-17)16(22-9)25-12-7-5-4-6-8-12;1-4-8(23-5(2)20)9(24-6(3)21)7(18-19-17)10(22-4)25-11(16)12(13,14)15/h4-9,13-16H,1-3H3;4,7-10,16H,1-3H3/b;16-11+ |
| InChIKey | JBAZPXYPOXWGAX-BDVCNMKHSA-N |
| XLogP | 3.94 |
| TPSA | 254.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.94 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|