C28H33Cl3N4O6 — CID 131739557
[(2R,3S,4R,5R)-5-azido-3,4-bis(3-phenylpropoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 131739557) has the molecular formula C28H33Cl3N4O6 and a molecular weight of 627.95 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-azido-3,4-bis(3-phenylpropoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-5-azido-3,4-bis(3-phenylpropoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 131739557 |
| Molecular Formula | C28H33Cl3N4O6 |
| Molecular Weight | 627.95 g/mol |
| Exact Mass | 626.15 |
| IUPAC Name | [(2R,3S,4R,5R)-5-azido-3,4-bis(3-phenylpropoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/OC1O[C@H](COC(C)=O)[C@@H](OCCCc2ccccc2)[C@H](OCCCc2ccccc2)[C@H]1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C28H33Cl3N4O6/c1-19(36)39-18-22-24(37-16-8-14-20-10-4-2-5-11-20)25(38-17-9-15-21-12-6-3-7-13-21)23(34-35-33)26(40-22)41-27(32)28(29,30)31/h2-7,10-13,22-26,32H,8-9,14-18H2,1H3/b32-27+/t22-,23-,24-,25-,26?/m1/s1 |
| InChIKey | KVMCMGVZSIFTSK-LIDGNLCUSA-N |
| XLogP | 6.35 |
| TPSA | 135.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.95 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|