C28H35N3O8Si — CID 70995860
[(3S,4S,6S)-3,4-diacetyloxy-5-azido-6-[tert-butyl(diphenyl)silyl]oxyoxan-2-yl]methyl acetate (PubChem CID 70995860) has the molecular formula C28H35N3O8Si and a molecular weight of 569.69 g/mol. Its IUPAC name is [(3S,4S,6S)-3,4-diacetyloxy-5-azido-6-[tert-butyl(diphenyl)silyl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(3S,4S,6S)-3,4-diacetyloxy-5-azido-6-[tert-butyl(diphenyl)silyl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70995860 |
| Molecular Formula | C28H35N3O8Si |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | [(3S,4S,6S)-3,4-diacetyloxy-5-azido-6-[tert-butyl(diphenyl)silyl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(N=[N+]=[N-])[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H35N3O8Si/c1-18(32)35-17-23-25(36-19(2)33)26(37-20(3)34)24(30-31-29)27(38-23)39-40(28(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,23-27H,17H2,1-6H3/t23?,24?,25-,26+,27+/m1/s1 |
| InChIKey | REQJSYJKDHKNCZ-FCZCUHCESA-N |
| XLogP | 3.39 |
| TPSA | 146.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|