C25H35N3O3Si — CID 71514367
3-[(4S,5R)-5-azido-2,2-dimethyl-1,3-dioxan-4-yl]propoxy-tert-butyl-diphenylsilane (PubChem CID 71514367) has the molecular formula C25H35N3O3Si and a molecular weight of 453.66 g/mol. Its IUPAC name is 3-[(4S,5R)-5-azido-2,2-dimethyl-1,3-dioxan-4-yl]propoxy-tert-butyl-diphenylsilane.
| Compound Name | 3-[(4S,5R)-5-azido-2,2-dimethyl-1,3-dioxan-4-yl]propoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 71514367 |
| Molecular Formula | C25H35N3O3Si |
| Molecular Weight | 453.66 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 3-[(4S,5R)-5-azido-2,2-dimethyl-1,3-dioxan-4-yl]propoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)OC[C@@H](N=[N+]=[N-])[C@H](CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C25H35N3O3Si/c1-24(2,3)32(20-13-8-6-9-14-20,21-15-10-7-11-16-21)30-18-12-17-23-22(27-28-26)19-29-25(4,5)31-23/h6-11,13-16,22-23H,12,17-19H2,1-5H3/t22-,23+/m1/s1 |
| InChIKey | JHQUYUVGWQMRFB-PKTZIBPZSA-N |
| XLogP | 5.17 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.66 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|