C28H41N3O3Si — CID 11656197
[(2S,3S)-2-azido-3-(oxan-2-yloxymethyl)hexoxy]-tert-butyl-diphenylsilane (PubChem CID 11656197) has the molecular formula C28H41N3O3Si and a molecular weight of 495.74 g/mol. Its IUPAC name is [(2S,3S)-2-azido-3-(oxan-2-yloxymethyl)hexoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2S,3S)-2-azido-3-(oxan-2-yloxymethyl)hexoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11656197 |
| Molecular Formula | C28H41N3O3Si |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | [(2S,3S)-2-azido-3-(oxan-2-yloxymethyl)hexoxy]-tert-butyl-diphenylsilane |
| SMILES | CCC[C@H](COC1CCCCO1)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N=[N+]=[N-] |
| InChI | InChI=1S/C28H41N3O3Si/c1-5-14-23(21-33-27-19-12-13-20-32-27)26(30-31-29)22-34-35(28(2,3)4,24-15-8-6-9-16-24)25-17-10-7-11-18-25/h6-11,15-18,23,26-27H,5,12-14,19-22H2,1-4H3/t23-,26-,27?/m1/s1 |
| InChIKey | QXPQUZYJGSBYEJ-UTZIHYNGSA-N |
| XLogP | 6.20 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|