C25H36N3O3Si- — CID 162048071
(3S,4R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-4-methyloxan-3-ol;carbanide (PubChem CID 162048071) has the molecular formula C25H36N3O3Si- and a molecular weight of 454.67 g/mol. Its IUPAC name is (3S,4R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-4-methyloxan-3-ol;carbanide.
| Compound Name | (3S,4R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-4-methyloxan-3-ol;carbanide |
|---|---|
| PubChem CID | 162048071 |
| Molecular Formula | C25H36N3O3Si- |
| Molecular Weight | 454.67 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | (3S,4R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-4-methyloxan-3-ol;carbanide |
| SMILES | CCC1O[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(N=[N+]=[N-])[C@@H](C)[C@@H]1O.[CH3-] |
| InChI | InChI=1S/C24H33N3O3Si.CH3/c1-6-20-22(28)17(2)21(26-27-25)23(29-20)30-31(24(3,4)5,18-13-9-7-10-14-18)19-15-11-8-12-16-19;/h7-17,20-23,28H,6H2,1-5H3;1H3/q;-1/t17-,20?,21?,22+,23+;/m1./s1 |
| InChIKey | YYECPTJFYBNOKO-FQCOIIMSSA-N |
| XLogP | 4.82 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|